MOQ:5
Quantity:200
Send Inquiry
| Methylone | |
| CAS | 186028-79-5 |
| Appearance: | White Powder BigCrystals |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.2258 |
| Formula Structure | |
| Content | 99.5% |
| InChl | InChI=1/C11H13NO3/c1-7(12-2)11(13)8-3-4-9-10(5-8)15-6-149/h3-5,7,12H, 6H2,1-2H3 |
| Density | 1.188g/cm3 |
| Boiling Point | 350.1°C at 760 mmHg |
| Flash Point | 165.5°C |
| Vapour Pressure | 4.5E-05mmHg at 25°C |
| Applications | Methylone is a ketoneanalogue of MDMA (Ecstasy). It has an almost antidepressant actionwith pleasant and positive. |
| Package | Aluminium foil bag oraccording to customers' requirement |
